C33H38ClN3O6 — CID 23980054
(5R,6S,7S)-2-N-(2-chlorophenyl)-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23980054) has the molecular formula C33H38ClN3O6 and a molecular weight of 608.14 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-(2-chlorophenyl)-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-(2-chlorophenyl)-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23980054 |
| Molecular Formula | C33H38ClN3O6 |
| Molecular Weight | 608.14 g/mol |
| Exact Mass | 607.24 |
| IUPAC Name | (5R,6S,7S)-2-N-(2-chlorophenyl)-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)[C@H]1[C@H]2C(=O)N(CCO)C(C(=O)N(CC=C)c3ccccc3Cl)C23CC[C@]1(C)O3)c1ccc(OCC)cc1 |
| InChI | InChI=1S/C33H38ClN3O6/c1-5-18-35(22-12-14-23(15-13-22)42-7-3)29(39)26-27-30(40)37(20-21-38)28(33(27)17-16-32(26,4)43-33)31(41)36(19-6-2)25-11-9-8-10-24(25)34/h5-6,8-15,26-28,38H,1-2,7,16-21H2,3-4H3/t26-,27+,28?,32+,33?/m1/s1 |
| InChIKey | CALGAIVLQWJFKZ-SUBYTZRVSA-N |
| XLogP | 4.23 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.14 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|