C25H31ClN2O6 — CID 23923100
(5R,6R,7R)-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-(5-hydroxypentyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid (PubChem CID 23923100) has the molecular formula C25H31ClN2O6 and a molecular weight of 490.98 g/mol. Its IUPAC name is (5R,6R,7R)-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-(5-hydroxypentyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid.
| Compound Name | (5R,6R,7R)-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-(5-hydroxypentyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
|---|---|
| PubChem CID | 23923100 |
| Molecular Formula | C25H31ClN2O6 |
| Molecular Weight | 490.98 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | (5R,6R,7R)-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-(5-hydroxypentyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
| SMILES | C=CCN(C(=O)C1N(CCCCCO)C(=O)[C@@H]2[C@@H](C(=O)O)[C@@]3(C)CCC12O3)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H31ClN2O6/c1-3-13-27(17-9-7-16(26)8-10-17)22(31)20-25-12-11-24(2,34-25)19(23(32)33)18(25)21(30)28(20)14-5-4-6-15-29/h3,7-10,18-20,29H,1,4-6,11-15H2,2H3,(H,32,33)/t18-,19-,20?,24+,25?/m0/s1 |
| InChIKey | WXIGFVVBRYIJAL-AQSYCGSKSA-N |
| XLogP | 2.87 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.98 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|