C36H45N3O5 — CID 23868479
(5R,6S,7S)-2-N,6-N-dibenzyl-3-(5-hydroxypentyl)-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23868479) has the molecular formula C36H45N3O5 and a molecular weight of 599.77 g/mol. Its IUPAC name is (5R,6S,7S)-2-N,6-N-dibenzyl-3-(5-hydroxypentyl)-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N,6-N-dibenzyl-3-(5-hydroxypentyl)-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23868479 |
| Molecular Formula | C36H45N3O5 |
| Molecular Weight | 599.77 g/mol |
| Exact Mass | 599.34 |
| IUPAC Name | (5R,6S,7S)-2-N,6-N-dibenzyl-3-(5-hydroxypentyl)-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)C1N(CCCCCO)C(=O)[C@@H]2[C@H](C(=O)N(CC=C)Cc3ccccc3)[C@]3(C)CCC12O3 |
| InChI | InChI=1S/C36H45N3O5/c1-4-21-37(25-27-15-9-6-10-16-27)32(41)29-30-33(42)39(23-13-8-14-24-40)31(36(30)20-19-35(29,3)44-36)34(43)38(22-5-2)26-28-17-11-7-12-18-28/h4-7,9-12,15-18,29-31,40H,1-2,8,13-14,19-26H2,3H3/t29-,30+,31?,35+,36?/m1/s1 |
| InChIKey | QIAINACBTJOPEE-CUNXNXGYSA-N |
| XLogP | 4.34 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.77 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|