C36H53N3O5 — CID 23783000
(5R,6R,7R)-6-N-benzyl-7-ethyl-3-(6-hydroxyhexyl)-4-oxo-2-N-pentyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23783000) has the molecular formula C36H53N3O5 and a molecular weight of 607.84 g/mol. Its IUPAC name is (5R,6R,7R)-6-N-benzyl-7-ethyl-3-(6-hydroxyhexyl)-4-oxo-2-N-pentyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-6-N-benzyl-7-ethyl-3-(6-hydroxyhexyl)-4-oxo-2-N-pentyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23783000 |
| Molecular Formula | C36H53N3O5 |
| Molecular Weight | 607.84 g/mol |
| Exact Mass | 607.40 |
| IUPAC Name | (5R,6R,7R)-6-N-benzyl-7-ethyl-3-(6-hydroxyhexyl)-4-oxo-2-N-pentyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCCCC)C(=O)C1N(CCCCCCO)C(=O)[C@@H]2[C@@H](C(=O)N(CC=C)Cc3ccccc3)[C@@]3(CC)CCC12O3 |
| InChI | InChI=1S/C36H53N3O5/c1-5-9-15-24-37(22-6-2)34(43)31-36-21-20-35(8-4,44-36)29(30(36)33(42)39(31)25-16-10-11-17-26-40)32(41)38(23-7-3)27-28-18-13-12-14-19-28/h6-7,12-14,18-19,29-31,40H,2-3,5,8-11,15-17,20-27H2,1,4H3/t29-,30-,31?,35+,36?/m0/s1 |
| InChIKey | HZPDIAYYYJUNSW-FAYRQPKASA-N |
| XLogP | 5.11 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.84 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|