C36H52N4O6 — CID 23896731
(5R,6R,7R)-6-N-benzyl-7-ethyl-3-(5-hydroxypentyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23896731) has the molecular formula C36H52N4O6 and a molecular weight of 636.83 g/mol. Its IUPAC name is (5R,6R,7R)-6-N-benzyl-7-ethyl-3-(5-hydroxypentyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-6-N-benzyl-7-ethyl-3-(5-hydroxypentyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23896731 |
| Molecular Formula | C36H52N4O6 |
| Molecular Weight | 636.83 g/mol |
| Exact Mass | 636.39 |
| IUPAC Name | (5R,6R,7R)-6-N-benzyl-7-ethyl-3-(5-hydroxypentyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCN1CCOCC1)C(=O)C1N(CCCCCO)C(=O)[C@@H]2[C@@H](C(=O)N(CC=C)Cc3ccccc3)[C@@]3(CC)CCC12O3 |
| InChI | InChI=1S/C36H52N4O6/c1-4-17-38(21-20-37-22-25-45-26-23-37)34(44)31-36-16-15-35(6-3,46-36)29(30(36)33(43)40(31)19-11-8-12-24-41)32(42)39(18-5-2)27-28-13-9-7-10-14-28/h4-5,7,9-10,13-14,29-31,41H,1-2,6,8,11-12,15-27H2,3H3/t29-,30-,31?,35+,36?/m0/s1 |
| InChIKey | ODELVSJPWIKDCV-FAYRQPKASA-N |
| XLogP | 2.87 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.83 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|