C34H48N4O6 — CID 23868714
(5R,6R,7R)-6-N-benzyl-7-ethyl-3-[(2R)-1-hydroxypropan-2-yl]-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23868714) has the molecular formula C34H48N4O6 and a molecular weight of 608.78 g/mol. Its IUPAC name is (5R,6R,7R)-6-N-benzyl-7-ethyl-3-[(2R)-1-hydroxypropan-2-yl]-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-6-N-benzyl-7-ethyl-3-[(2R)-1-hydroxypropan-2-yl]-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23868714 |
| Molecular Formula | C34H48N4O6 |
| Molecular Weight | 608.78 g/mol |
| Exact Mass | 608.36 |
| IUPAC Name | (5R,6R,7R)-6-N-benzyl-7-ethyl-3-[(2R)-1-hydroxypropan-2-yl]-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCN1CCOCC1)C(=O)C1N([C@H](C)CO)C(=O)[C@@H]2[C@@H](C(=O)N(CC=C)Cc3ccccc3)[C@@]3(CC)CCC12O3 |
| InChI | InChI=1S/C34H48N4O6/c1-5-15-36(18-17-35-19-21-43-22-20-35)32(42)29-34-14-13-33(7-3,44-34)27(28(34)31(41)38(29)25(4)24-39)30(40)37(16-6-2)23-26-11-9-8-10-12-26/h5-6,8-12,25,27-29,39H,1-2,7,13-24H2,3-4H3/t25-,27+,28+,29?,33-,34?/m1/s1 |
| InChIKey | HJPDCENCRMLERZ-MHPIKVMVSA-N |
| XLogP | 2.08 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.78 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|