C38H49N3O5 — CID 23924674
(5R,6R,7R)-2-N,6-N-dibenzyl-7-ethyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23924674) has the molecular formula C38H49N3O5 and a molecular weight of 627.83 g/mol. Its IUPAC name is (5R,6R,7R)-2-N,6-N-dibenzyl-7-ethyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-2-N,6-N-dibenzyl-7-ethyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23924674 |
| Molecular Formula | C38H49N3O5 |
| Molecular Weight | 627.83 g/mol |
| Exact Mass | 627.37 |
| IUPAC Name | (5R,6R,7R)-2-N,6-N-dibenzyl-7-ethyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)C1N(C(CO)CC(C)C)C(=O)[C@@H]2[C@@H](C(=O)N(CC=C)Cc3ccccc3)[C@@]3(CC)CCC12O3 |
| InChI | InChI=1S/C38H49N3O5/c1-6-21-39(24-28-15-11-9-12-16-28)34(43)31-32-35(44)41(30(26-42)23-27(4)5)33(38(32)20-19-37(31,8-3)46-38)36(45)40(22-7-2)25-29-17-13-10-14-18-29/h6-7,9-18,27,30-33,42H,1-2,8,19-26H2,3-5H3/t30?,31-,32-,33?,37+,38?/m0/s1 |
| InChIKey | HHOCIVJLUWQFNX-FVTDGTQQSA-N |
| XLogP | 4.98 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.83 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|