C39H51N3O5 — CID 23782439
(5R,6S,7S)-6-N-benzyl-7-ethyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-2-N-pentan-2-yl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23782439) has the molecular formula C39H51N3O5 and a molecular weight of 641.85 g/mol. Its IUPAC name is (5R,6S,7S)-6-N-benzyl-7-ethyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-2-N-pentan-2-yl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-6-N-benzyl-7-ethyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-2-N-pentan-2-yl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23782439 |
| Molecular Formula | C39H51N3O5 |
| Molecular Weight | 641.85 g/mol |
| Exact Mass | 641.38 |
| IUPAC Name | (5R,6S,7S)-6-N-benzyl-7-ethyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-2-N-pentan-2-yl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)[C@H]1[C@H]2C(=O)N([C@@H](CO)Cc3ccccc3)C(C(=O)N(CC=C)C(C)CCC)C23CC[C@]1(CC)O3 |
| InChI | InChI=1S/C39H51N3O5/c1-6-16-28(5)41(24-8-3)37(46)34-39-22-21-38(9-4,47-39)32(35(44)40(23-7-2)26-30-19-14-11-15-20-30)33(39)36(45)42(34)31(27-43)25-29-17-12-10-13-18-29/h7-8,10-15,17-20,28,31-34,43H,2-3,6,9,16,21-27H2,1,4-5H3/t28?,31-,32-,33+,34?,38+,39?/m1/s1 |
| InChIKey | FATABDQKWRKSDK-PKYBBZCOSA-N |
| XLogP | 5.16 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.85 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|