C36H44ClN3O5 — CID 23980177
(5R,6S,7S)-2-N-(2-chlorophenyl)-7-ethyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23980177) has the molecular formula C36H44ClN3O5 and a molecular weight of 634.22 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-(2-chlorophenyl)-7-ethyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-(2-chlorophenyl)-7-ethyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23980177 |
| Molecular Formula | C36H44ClN3O5 |
| Molecular Weight | 634.22 g/mol |
| Exact Mass | 633.30 |
| IUPAC Name | (5R,6S,7S)-2-N-(2-chlorophenyl)-7-ethyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCC)C(=O)[C@H]1[C@H]2C(=O)N([C@@H](CO)Cc3ccccc3)C(C(=O)N(CC=C)c3ccccc3Cl)C23CC[C@]1(CC)O3 |
| InChI | InChI=1S/C36H44ClN3O5/c1-5-20-38(21-6-2)32(42)29-30-33(43)40(26(24-41)23-25-14-10-9-11-15-25)31(36(30)19-18-35(29,8-4)45-36)34(44)39(22-7-3)28-17-13-12-16-27(28)37/h5,7,9-17,26,29-31,41H,1,3,6,8,18-24H2,2,4H3/t26-,29-,30+,31?,35+,36?/m1/s1 |
| InChIKey | ZIGQXBYUQFDFCY-JIKLMQNRSA-N |
| XLogP | 5.04 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.22 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|