C40H47N3O5 — CID 23840550
(5R,6R,7R)-7-ethyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23840550) has the molecular formula C40H47N3O5 and a molecular weight of 649.83 g/mol. Its IUPAC name is (5R,6R,7R)-7-ethyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-7-ethyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23840550 |
| Molecular Formula | C40H47N3O5 |
| Molecular Weight | 649.83 g/mol |
| Exact Mass | 649.35 |
| IUPAC Name | (5R,6R,7R)-7-ethyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCC)C(=O)[C@@H]1[C@H]2C(=O)N([C@@H](CO)Cc3ccccc3)C(C(=O)N(CC=C)c3ccc4ccccc4c3)C23CC[C@@]1(CC)O3 |
| InChI | InChI=1S/C40H47N3O5/c1-5-22-41(23-6-2)36(45)33-34-37(46)43(32(27-44)25-28-14-10-9-11-15-28)35(40(34)21-20-39(33,8-4)48-40)38(47)42(24-7-3)31-19-18-29-16-12-13-17-30(29)26-31/h5,7,9-19,26,32-35,44H,1,3,6,8,20-25,27H2,2,4H3/t32-,33+,34+,35?,39-,40?/m1/s1 |
| InChIKey | DLOJVJOCQOBIED-ULIYAXNMSA-N |
| XLogP | 5.54 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.83 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|