C32H45N3O6 — CID 23783102
(5R,6R,7R)-7-ethyl-3-[(2S)-1-hydroxybutan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23783102) has the molecular formula C32H45N3O6 and a molecular weight of 567.73 g/mol. Its IUPAC name is (5R,6R,7R)-7-ethyl-3-[(2S)-1-hydroxybutan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-7-ethyl-3-[(2S)-1-hydroxybutan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23783102 |
| Molecular Formula | C32H45N3O6 |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.33 |
| IUPAC Name | (5R,6R,7R)-7-ethyl-3-[(2S)-1-hydroxybutan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCC)C(=O)[C@@H]1[C@H]2C(=O)N(C(CC)CO)C(C(=O)N(CC=C)c3ccc(OC)cc3)C23CC[C@@]1(CC)O3 |
| InChI | InChI=1S/C32H45N3O6/c1-7-18-33(19-8-2)28(37)25-26-29(38)35(22(10-4)21-36)27(32(26)17-16-31(25,11-5)41-32)30(39)34(20-9-3)23-12-14-24(40-6)15-13-23/h7,9,12-15,22,25-27,36H,1,3,8,10-11,16-21H2,2,4-6H3/t22?,25-,26-,27?,31+,32?/m0/s1 |
| InChIKey | DCTFNMMYXQLEPG-WZGGXILBSA-N |
| XLogP | 3.56 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|