C39H43N3O6 — CID 23812025
(5R,6R,7R)-7-ethyl-3-[(1S)-2-hydroxy-1-phenylethyl]-2-N-(4-methoxyphenyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23812025) has the molecular formula C39H43N3O6 and a molecular weight of 649.79 g/mol. Its IUPAC name is (5R,6R,7R)-7-ethyl-3-[(1S)-2-hydroxy-1-phenylethyl]-2-N-(4-methoxyphenyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-7-ethyl-3-[(1S)-2-hydroxy-1-phenylethyl]-2-N-(4-methoxyphenyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23812025 |
| Molecular Formula | C39H43N3O6 |
| Molecular Weight | 649.79 g/mol |
| Exact Mass | 649.32 |
| IUPAC Name | (5R,6R,7R)-7-ethyl-3-[(1S)-2-hydroxy-1-phenylethyl]-2-N-(4-methoxyphenyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)C1N([C@H](CO)c2ccccc2)C(=O)[C@@H]2[C@@H](C(=O)N(CC=C)c3ccccc3)[C@@]3(CC)CCC12O3)c1ccc(OC)cc1 |
| InChI | InChI=1S/C39H43N3O6/c1-5-24-40(28-16-12-9-13-17-28)35(44)32-33-36(45)42(31(26-43)27-14-10-8-11-15-27)34(39(33)23-22-38(32,7-3)48-39)37(46)41(25-6-2)29-18-20-30(47-4)21-19-29/h5-6,8-21,31-34,43H,1-2,7,22-26H2,3-4H3/t31-,32+,33+,34?,38-,39?/m1/s1 |
| InChIKey | SJPUMSGAGVOXON-CKLZHCLMSA-N |
| XLogP | 5.32 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.79 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|