C39H42ClN3O5 — CID 23924710
(5R,6R,7R)-6-N-benzyl-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23924710) has the molecular formula C39H42ClN3O5 and a molecular weight of 668.23 g/mol. Its IUPAC name is (5R,6R,7R)-6-N-benzyl-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-6-N-benzyl-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23924710 |
| Molecular Formula | C39H42ClN3O5 |
| Molecular Weight | 668.23 g/mol |
| Exact Mass | 667.28 |
| IUPAC Name | (5R,6R,7R)-6-N-benzyl-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)[C@@H]1[C@H]2C(=O)N([C@@H](CO)Cc3ccccc3)C(C(=O)N(CC=C)c3ccccc3Cl)C23CC[C@@]1(C)O3 |
| InChI | InChI=1S/C39H42ClN3O5/c1-4-22-41(25-28-16-10-7-11-17-28)35(45)32-33-36(46)43(29(26-44)24-27-14-8-6-9-15-27)34(39(33)21-20-38(32,3)48-39)37(47)42(23-5-2)31-19-13-12-18-30(31)40/h4-19,29,32-34,44H,1-2,20-26H2,3H3/t29-,32+,33+,34?,38-,39?/m1/s1 |
| InChIKey | YQFXHOWTEAJDJZ-AFUBAEJLSA-N |
| XLogP | 5.44 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.23 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|