C38H56N4O7 — CID 23811552
(5R,6S,7S)-6-N-(4-ethoxyphenyl)-7-ethyl-3-(6-hydroxyhexyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23811552) has the molecular formula C38H56N4O7 and a molecular weight of 680.89 g/mol. Its IUPAC name is (5R,6S,7S)-6-N-(4-ethoxyphenyl)-7-ethyl-3-(6-hydroxyhexyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-6-N-(4-ethoxyphenyl)-7-ethyl-3-(6-hydroxyhexyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23811552 |
| Molecular Formula | C38H56N4O7 |
| Molecular Weight | 680.89 g/mol |
| Exact Mass | 680.41 |
| IUPAC Name | (5R,6S,7S)-6-N-(4-ethoxyphenyl)-7-ethyl-3-(6-hydroxyhexyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCN1CCOCC1)C(=O)C1N(CCCCCCO)C(=O)[C@@H]2[C@H](C(=O)N(CC=C)c3ccc(OCC)cc3)[C@]3(CC)CCC12O3 |
| InChI | InChI=1S/C38H56N4O7/c1-5-19-40(23-22-39-24-27-47-28-25-39)36(46)33-38-18-17-37(7-3,49-38)31(32(38)35(45)42(33)21-11-9-10-12-26-43)34(44)41(20-6-2)29-13-15-30(16-14-29)48-8-4/h5-6,13-16,31-33,43H,1-2,7-12,17-28H2,3-4H3/t31-,32+,33?,37+,38?/m1/s1 |
| InChIKey | NYKCPQQCOUNCFF-VFCSSWKASA-N |
| XLogP | 3.66 |
| TPSA | 112.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.89 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|