C36H52N4O7 — CID 23868499
(5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23868499) has the molecular formula C36H52N4O7 and a molecular weight of 652.83 g/mol. Its IUPAC name is (5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23868499 |
| Molecular Formula | C36H52N4O7 |
| Molecular Weight | 652.83 g/mol |
| Exact Mass | 652.38 |
| IUPAC Name | (5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCN1CCOCC1)C(=O)C1N(CCCCCCO)C(=O)[C@@H]2[C@H](C(=O)N(CC=C)c3ccc(OCC)cc3)[C@@H]3CCC12O3 |
| InChI | InChI=1S/C36H52N4O7/c1-4-17-38(21-20-37-22-25-45-26-23-37)35(44)32-36-16-15-29(47-36)30(31(36)34(43)40(32)19-9-7-8-10-24-41)33(42)39(18-5-2)27-11-13-28(14-12-27)46-6-3/h4-5,11-14,29-32,41H,1-2,6-10,15-26H2,3H3/t29-,30+,31-,32?,36?/m0/s1 |
| InChIKey | IYPBDGFJQRMWFW-UWOJZKNKSA-N |
| XLogP | 2.88 |
| TPSA | 112.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.83 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|