C31H42ClN3O5 — CID 23982029
(5R,6S,7S)-2-N-(4-chlorophenyl)-3-(6-hydroxyhexyl)-6-N,7,8-trimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23982029) has the molecular formula C31H42ClN3O5 and a molecular weight of 572.15 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-(4-chlorophenyl)-3-(6-hydroxyhexyl)-6-N,7,8-trimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-(4-chlorophenyl)-3-(6-hydroxyhexyl)-6-N,7,8-trimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23982029 |
| Molecular Formula | C31H42ClN3O5 |
| Molecular Weight | 572.15 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | (5R,6S,7S)-2-N-(4-chlorophenyl)-3-(6-hydroxyhexyl)-6-N,7,8-trimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C)C(=O)[C@H]1[C@H]2C(=O)N(CCCCCCO)C(C(=O)N(CC=C)c3ccc(Cl)cc3)C23CC(C)[C@]1(C)O3 |
| InChI | InChI=1S/C31H42ClN3O5/c1-6-16-33(5)27(37)24-25-28(38)35(18-10-8-9-11-19-36)26(31(25)20-21(3)30(24,4)40-31)29(39)34(17-7-2)23-14-12-22(32)13-15-23/h6-7,12-15,21,24-26,36H,1-2,8-11,16-20H2,3-5H3/t21?,24-,25+,26?,30+,31?/m1/s1 |
| InChIKey | JMJOAGRWUJHNGU-YXFGOBLLSA-N |
| XLogP | 4.07 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.15 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|