C35H52N4O5 — CID 23813717
(5R,6R,7R)-2-N-[4-(diethylamino)phenyl]-3-(6-hydroxyhexyl)-6-N,7,8-trimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23813717) has the molecular formula C35H52N4O5 and a molecular weight of 608.82 g/mol. Its IUPAC name is (5R,6R,7R)-2-N-[4-(diethylamino)phenyl]-3-(6-hydroxyhexyl)-6-N,7,8-trimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-2-N-[4-(diethylamino)phenyl]-3-(6-hydroxyhexyl)-6-N,7,8-trimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23813717 |
| Molecular Formula | C35H52N4O5 |
| Molecular Weight | 608.82 g/mol |
| Exact Mass | 608.39 |
| IUPAC Name | (5R,6R,7R)-2-N-[4-(diethylamino)phenyl]-3-(6-hydroxyhexyl)-6-N,7,8-trimethyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C)C(=O)[C@@H]1[C@H]2C(=O)N(CCCCCCO)C(C(=O)N(CC=C)c3ccc(N(CC)CC)cc3)C23CC(C)[C@@]1(C)O3 |
| InChI | InChI=1S/C35H52N4O5/c1-8-20-36(7)31(41)28-29-32(42)39(22-14-12-13-15-23-40)30(35(29)24-25(5)34(28,6)44-35)33(43)38(21-9-2)27-18-16-26(17-19-27)37(10-3)11-4/h8-9,16-19,25,28-30,40H,1-2,10-15,20-24H2,3-7H3/t25?,28-,29-,30?,34+,35?/m0/s1 |
| InChIKey | VYKQWXVQYIBNLT-OPOLREHMSA-N |
| XLogP | 4.26 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.82 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|