C36H53N3O5 — CID 23982087
(5R,6S,7S)-3-[(2S)-1-hydroxybutan-2-yl]-7,8-dimethyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23982087) has the molecular formula C36H53N3O5 and a molecular weight of 607.84 g/mol. Its IUPAC name is (5R,6S,7S)-3-[(2S)-1-hydroxybutan-2-yl]-7,8-dimethyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-3-[(2S)-1-hydroxybutan-2-yl]-7,8-dimethyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23982087 |
| Molecular Formula | C36H53N3O5 |
| Molecular Weight | 607.84 g/mol |
| Exact Mass | 607.40 |
| IUPAC Name | (5R,6S,7S)-3-[(2S)-1-hydroxybutan-2-yl]-7,8-dimethyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)[C@H]1[C@H]2C(=O)N([C@@H](CC)CO)C(C(=O)N(CC=C)C(C)(C)CC(C)(C)C)C23CC(C)[C@]1(C)O3)c1ccccc1 |
| InChI | InChI=1S/C36H53N3O5/c1-11-19-37(26-17-15-14-16-18-26)30(41)27-28-31(42)39(25(13-3)22-40)29(36(28)21-24(4)35(27,10)44-36)32(43)38(20-12-2)34(8,9)23-33(5,6)7/h11-12,14-18,24-25,27-29,40H,1-2,13,19-23H2,3-10H3/t24?,25-,27+,28-,29?,35-,36?/m0/s1 |
| InChIKey | AYMLUKRGUBOTPI-VYIVSVMZSA-N |
| XLogP | 5.22 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.84 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|