C30H41N3O5 — CID 23813372
(5R,6S,7S)-2-N-tert-butyl-3-(2-hydroxyethyl)-7,8-dimethyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23813372) has the molecular formula C30H41N3O5 and a molecular weight of 523.67 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-tert-butyl-3-(2-hydroxyethyl)-7,8-dimethyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-tert-butyl-3-(2-hydroxyethyl)-7,8-dimethyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23813372 |
| Molecular Formula | C30H41N3O5 |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.30 |
| IUPAC Name | (5R,6S,7S)-2-N-tert-butyl-3-(2-hydroxyethyl)-7,8-dimethyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)[C@H]1[C@H]2C(=O)N(CCO)C(C(=O)N(CC=C)C(C)(C)C)C23CC(C)[C@]1(C)O3)c1ccccc1 |
| InChI | InChI=1S/C30H41N3O5/c1-8-15-31(21-13-11-10-12-14-21)25(35)22-23-26(36)32(17-18-34)24(27(37)33(16-9-2)28(4,5)6)30(23)19-20(3)29(22,7)38-30/h8-14,20,22-24,34H,1-2,15-19H2,3-7H3/t20?,22-,23+,24?,29+,30?/m1/s1 |
| InChIKey | YMZLHSBIVIMCGY-KLTWAMGKSA-N |
| XLogP | 3.02 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|