C29H36BrN5O5S — CID 23951489
but-3-enyl (5S,6R,7R)-2-[benzotriazol-1-ylmethyl(prop-2-enyl)carbamoyl]-8-bromo-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23951489) has the molecular formula C29H36BrN5O5S and a molecular weight of 646.61 g/mol. Its IUPAC name is but-3-enyl (5S,6R,7R)-2-[benzotriazol-1-ylmethyl(prop-2-enyl)carbamoyl]-8-bromo-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | but-3-enyl (5S,6R,7R)-2-[benzotriazol-1-ylmethyl(prop-2-enyl)carbamoyl]-8-bromo-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23951489 |
| Molecular Formula | C29H36BrN5O5S |
| Molecular Weight | 646.61 g/mol |
| Exact Mass | 645.16 |
| IUPAC Name | but-3-enyl (5S,6R,7R)-2-[benzotriazol-1-ylmethyl(prop-2-enyl)carbamoyl]-8-bromo-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCOC(=O)[C@H]1[C@H]2C(=O)N(CCCCCO)C(C(=O)N(CC=C)Cn3nnc4ccccc43)C23CC(Br)[C@@H]1S3 |
| InChI | InChI=1S/C29H36BrN5O5S/c1-3-5-16-40-28(39)22-23-26(37)34(14-9-6-10-15-36)25(29(23)17-19(30)24(22)41-29)27(38)33(13-4-2)18-35-21-12-8-7-11-20(21)31-32-35/h3-4,7-8,11-12,19,22-25,36H,1-2,5-6,9-10,13-18H2/t19?,22-,23-,24-,25?,29?/m0/s1 |
| InChIKey | TYZLQEOVJYKBKZ-OJUGJYHISA-N |
| XLogP | 3.15 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.61 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|