C32H42BrN5O6 — CID 23868084
hex-5-enyl (5R,6R,7S)-2-[benzotriazol-1-ylmethyl(prop-2-enyl)carbamoyl]-8-bromo-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23868084) has the molecular formula C32H42BrN5O6 and a molecular weight of 672.62 g/mol. Its IUPAC name is hex-5-enyl (5R,6R,7S)-2-[benzotriazol-1-ylmethyl(prop-2-enyl)carbamoyl]-8-bromo-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | hex-5-enyl (5R,6R,7S)-2-[benzotriazol-1-ylmethyl(prop-2-enyl)carbamoyl]-8-bromo-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23868084 |
| Molecular Formula | C32H42BrN5O6 |
| Molecular Weight | 672.62 g/mol |
| Exact Mass | 671.23 |
| IUPAC Name | hex-5-enyl (5R,6R,7S)-2-[benzotriazol-1-ylmethyl(prop-2-enyl)carbamoyl]-8-bromo-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCCOC(=O)[C@H]1[C@@H]2OC3(CC2Br)C(C(=O)N(CC=C)Cn2nnc4ccccc42)N(CCCCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C32H42BrN5O6/c1-3-5-6-13-19-43-31(42)25-26-29(40)37(17-11-7-8-12-18-39)28(32(26)20-22(33)27(25)44-32)30(41)36(16-4-2)21-38-24-15-10-9-14-23(24)34-35-38/h3-4,9-10,14-15,22,25-28,39H,1-2,5-8,11-13,16-21H2/t22?,25-,26+,27-,28?,32?/m1/s1 |
| InChIKey | GQCJUKVRRAJOHF-ZNLNAKDCSA-N |
| XLogP | 3.60 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.62 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|