C30H39BrN4O5S — CID 23783780
(5S,6R,7R)-8-bromo-3-(2-hydroxyethyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23783780) has the molecular formula C30H39BrN4O5S and a molecular weight of 647.64 g/mol. Its IUPAC name is (5S,6R,7R)-8-bromo-3-(2-hydroxyethyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7R)-8-bromo-3-(2-hydroxyethyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23783780 |
| Molecular Formula | C30H39BrN4O5S |
| Molecular Weight | 647.64 g/mol |
| Exact Mass | 646.18 |
| IUPAC Name | (5S,6R,7R)-8-bromo-3-(2-hydroxyethyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCN1CCOCC1)C(=O)C1N(CCO)C(=O)[C@@H]2[C@H](C(=O)N(CC=C)c3ccccc3)[C@H]3SC12CC3Br |
| InChI | InChI=1S/C30H39BrN4O5S/c1-3-10-33(13-12-32-15-18-40-19-16-32)29(39)26-30-20-22(31)25(41-30)23(24(30)28(38)35(26)14-17-36)27(37)34(11-4-2)21-8-6-5-7-9-21/h3-9,22-26,36H,1-2,10-20H2/t22?,23-,24-,25-,26?,30?/m0/s1 |
| InChIKey | VWYGJFMQILTIEC-DVMXDDCXSA-N |
| XLogP | 2.01 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.64 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|