C28H38N2O5S — CID 23951557
(5S,6R,7S)-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid (PubChem CID 23951557) has the molecular formula C28H38N2O5S and a molecular weight of 514.69 g/mol. Its IUPAC name is (5S,6R,7S)-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid.
| Compound Name | (5S,6R,7S)-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
|---|---|
| PubChem CID | 23951557 |
| Molecular Formula | C28H38N2O5S |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | (5S,6R,7S)-2-[(2,5-dimethylphenyl)-prop-2-enylcarbamoyl]-3-(6-hydroxyhexyl)-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
| SMILES | C=CCN(C(=O)C1N(CCCCCCO)C(=O)[C@@H]2[C@H](C(=O)O)[C@@H]3CC(C)C12S3)c1cc(C)ccc1C |
| InChI | InChI=1S/C28H38N2O5S/c1-5-12-29(20-15-17(2)10-11-18(20)3)26(33)24-28-19(4)16-21(36-28)22(27(34)35)23(28)25(32)30(24)13-8-6-7-9-14-31/h5,10-11,15,19,21-24,31H,1,6-9,12-14,16H2,2-4H3,(H,34,35)/t19?,21-,22+,23-,24?,28?/m0/s1 |
| InChIKey | FSNBWAXTOJIDNZ-QZVWVFPVSA-N |
| XLogP | 3.80 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|