C28H39N3O5S — CID 23811008
(5S,6S,7R)-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-(4-hydroxybutyl)-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid (PubChem CID 23811008) has the molecular formula C28H39N3O5S and a molecular weight of 529.70 g/mol. Its IUPAC name is (5S,6S,7R)-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-(4-hydroxybutyl)-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid.
| Compound Name | (5S,6S,7R)-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-(4-hydroxybutyl)-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
|---|---|
| PubChem CID | 23811008 |
| Molecular Formula | C28H39N3O5S |
| Molecular Weight | 529.70 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | (5S,6S,7R)-2-[[4-(diethylamino)phenyl]-prop-2-enylcarbamoyl]-3-(4-hydroxybutyl)-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
| SMILES | C=CCN(C(=O)C1N(CCCCO)C(=O)[C@@H]2[C@@H](C(=O)O)[C@H]3CC(C)C12S3)c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C28H39N3O5S/c1-5-14-30(20-12-10-19(11-13-20)29(6-2)7-3)26(34)24-28-18(4)17-21(37-28)22(27(35)36)23(28)25(33)31(24)15-8-9-16-32/h5,10-13,18,21-24,32H,1,6-9,14-17H2,2-4H3,(H,35,36)/t18?,21-,22+,23+,24?,28?/m1/s1 |
| InChIKey | BBNYKXZOINICNE-YUNJEGMDSA-N |
| XLogP | 3.25 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.70 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|