C26H34N2O6S — CID 23781886
(5S,6R,7S)-3-(5-hydroxypentyl)-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid (PubChem CID 23781886) has the molecular formula C26H34N2O6S and a molecular weight of 502.63 g/mol. Its IUPAC name is (5S,6R,7S)-3-(5-hydroxypentyl)-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid.
| Compound Name | (5S,6R,7S)-3-(5-hydroxypentyl)-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
|---|---|
| PubChem CID | 23781886 |
| Molecular Formula | C26H34N2O6S |
| Molecular Weight | 502.63 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | (5S,6R,7S)-3-(5-hydroxypentyl)-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
| SMILES | C=CCN(C(=O)C1N(CCCCCO)C(=O)[C@@H]2[C@H](C(=O)O)[C@@H]3CC(C)C12S3)c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H34N2O6S/c1-4-12-27(17-8-10-18(34-3)11-9-17)24(31)22-26-16(2)15-19(35-26)20(25(32)33)21(26)23(30)28(22)13-6-5-7-14-29/h4,8-11,16,19-22,29H,1,5-7,12-15H2,2-3H3,(H,32,33)/t16?,19-,20+,21-,22?,26?/m0/s1 |
| InChIKey | WYTCAJXWTLUCKJ-WZPBAANPSA-N |
| XLogP | 2.80 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.63 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|