C39H45N3O4S — CID 23812749
(5S,6R,7S)-6-N-benzyl-3-(5-hydroxypentyl)-9-methyl-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23812749) has the molecular formula C39H45N3O4S and a molecular weight of 651.87 g/mol. Its IUPAC name is (5S,6R,7S)-6-N-benzyl-3-(5-hydroxypentyl)-9-methyl-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-6-N-benzyl-3-(5-hydroxypentyl)-9-methyl-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23812749 |
| Molecular Formula | C39H45N3O4S |
| Molecular Weight | 651.87 g/mol |
| Exact Mass | 651.31 |
| IUPAC Name | (5S,6R,7S)-6-N-benzyl-3-(5-hydroxypentyl)-9-methyl-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)[C@@H]1[C@@H]2CC(C)C3(S2)C(C(=O)N(CC=C)c2ccc4ccccc4c2)N(CCCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C39H45N3O4S/c1-4-20-40(26-28-14-8-6-9-15-28)36(44)33-32-24-27(3)39(47-32)34(33)37(45)42(22-12-7-13-23-43)35(39)38(46)41(21-5-2)31-19-18-29-16-10-11-17-30(29)25-31/h4-6,8-11,14-19,25,27,32-35,43H,1-2,7,12-13,20-24,26H2,3H3/t27?,32-,33+,34-,35?,39?/m0/s1 |
| InChIKey | JXGICHCRZBPXRB-RDMQEJPUSA-N |
| XLogP | 6.07 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.87 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|