C37H41N3O5S — CID 23981686
(5S,6S,7R)-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-9-methyl-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23981686) has the molecular formula C37H41N3O5S and a molecular weight of 639.82 g/mol. Its IUPAC name is (5S,6S,7R)-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-9-methyl-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-9-methyl-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23981686 |
| Molecular Formula | C37H41N3O5S |
| Molecular Weight | 639.82 g/mol |
| Exact Mass | 639.28 |
| IUPAC Name | (5S,6S,7R)-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-9-methyl-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)C1N(CCO)C(=O)[C@@H]2[C@@H](C(=O)N(CC=C)c3ccc(OCC)cc3)[C@H]3CC(C)C12S3)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C37H41N3O5S/c1-5-18-38(27-14-16-29(17-15-27)45-7-3)34(42)31-30-22-24(4)37(46-30)32(31)35(43)40(20-21-41)33(37)36(44)39(19-6-2)28-13-12-25-10-8-9-11-26(25)23-28/h5-6,8-17,23-24,30-33,41H,1-2,7,18-22H2,3-4H3/t24?,30-,31+,32+,33?,37?/m1/s1 |
| InChIKey | GHFCMUKDAMAJSO-RCKGBPEOSA-N |
| XLogP | 5.31 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.82 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|