C32H45N3O5S — CID 23953885
(5S,6S,7R)-2-N-tert-butyl-6-N-(4-ethoxyphenyl)-3-(3-hydroxypropyl)-9-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23953885) has the molecular formula C32H45N3O5S and a molecular weight of 583.80 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-tert-butyl-6-N-(4-ethoxyphenyl)-3-(3-hydroxypropyl)-9-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-tert-butyl-6-N-(4-ethoxyphenyl)-3-(3-hydroxypropyl)-9-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23953885 |
| Molecular Formula | C32H45N3O5S |
| Molecular Weight | 583.80 g/mol |
| Exact Mass | 583.31 |
| IUPAC Name | (5S,6S,7R)-2-N-tert-butyl-6-N-(4-ethoxyphenyl)-3-(3-hydroxypropyl)-9-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)[C@@H]1[C@H]2C(=O)N(CCCO)C(C(=O)N(CC=C)C(C)(C)C)C23S[C@@H]1CC3C)c1ccc(OCC)cc1 |
| InChI | InChI=1S/C32H45N3O5S/c1-8-16-33(22-12-14-23(15-13-22)40-10-3)28(37)25-24-20-21(4)32(41-24)26(25)29(38)34(18-11-19-36)27(32)30(39)35(17-9-2)31(5,6)7/h8-9,12-15,21,24-27,36H,1-2,10-11,16-20H2,3-7H3/t21?,24-,25+,26+,27?,32?/m1/s1 |
| InChIKey | QYLAZKZYBLJLHC-PIDAOQBBSA-N |
| XLogP | 4.14 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.80 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|