C39H43N3O4S — CID 25091774
(5S,6R,7S)-2-N-(2,5-dimethylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-9-methyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 25091774) has the molecular formula C39H43N3O4S and a molecular weight of 649.86 g/mol. Its IUPAC name is (5S,6R,7S)-2-N-(2,5-dimethylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-9-methyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-2-N-(2,5-dimethylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-9-methyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 25091774 |
| Molecular Formula | C39H43N3O4S |
| Molecular Weight | 649.86 g/mol |
| Exact Mass | 649.30 |
| IUPAC Name | (5S,6R,7S)-2-N-(2,5-dimethylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-9-methyl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)[C@@H]1[C@@H]2CC(C)C3(S2)C(C(=O)N(CC=C)c2cc(C)ccc2C)N([C@H](CO)c2ccccc2)C(=O)[C@H]13)c1ccccc1 |
| InChI | InChI=1S/C39H43N3O4S/c1-6-20-40(29-16-12-9-13-17-29)36(44)33-32-23-27(5)39(47-32)34(33)37(45)42(31(24-43)28-14-10-8-11-15-28)35(39)38(46)41(21-7-2)30-22-25(3)18-19-26(30)4/h6-19,22,27,31-35,43H,1-2,20-21,23-24H2,3-5H3/t27?,31-,32+,33-,34+,35?,39?/m1/s1 |
| InChIKey | DOESTXLVQNBUGM-RXQSCBRTSA-N |
| XLogP | 6.11 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.86 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|