C40H45N3O4S — CID 25088859
(5S,6S,7R)-6-N-benzyl-2-N-(2,5-dimethylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-9-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 25088859) has the molecular formula C40H45N3O4S and a molecular weight of 663.88 g/mol. Its IUPAC name is (5S,6S,7R)-6-N-benzyl-2-N-(2,5-dimethylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-9-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-6-N-benzyl-2-N-(2,5-dimethylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-9-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 25088859 |
| Molecular Formula | C40H45N3O4S |
| Molecular Weight | 663.88 g/mol |
| Exact Mass | 663.31 |
| IUPAC Name | (5S,6S,7R)-6-N-benzyl-2-N-(2,5-dimethylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-9-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)[C@@H]1[C@H]2C(=O)N([C@H](CO)c3ccccc3)C(C(=O)N(CC=C)c3cc(C)ccc3C)C23S[C@@H]1CC3C |
| InChI | InChI=1S/C40H45N3O4S/c1-6-20-41(24-29-14-10-8-11-15-29)37(45)34-33-23-28(5)40(48-33)35(34)38(46)43(32(25-44)30-16-12-9-13-17-30)36(40)39(47)42(21-7-2)31-22-26(3)18-19-27(31)4/h6-19,22,28,32-36,44H,1-2,20-21,23-25H2,3-5H3/t28?,32-,33-,34+,35+,36?,40?/m1/s1 |
| InChIKey | KTTADFLEHSYYPV-IOMFAGLQSA-N |
| XLogP | 6.11 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.88 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|