C39H43N3O5S — CID 23754921
(5S,6S,7R)-6-N-benzyl-3-[(1S)-2-hydroxy-1-phenylethyl]-2-N-(4-methoxyphenyl)-9-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23754921) has the molecular formula C39H43N3O5S and a molecular weight of 665.86 g/mol. Its IUPAC name is (5S,6S,7R)-6-N-benzyl-3-[(1S)-2-hydroxy-1-phenylethyl]-2-N-(4-methoxyphenyl)-9-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-6-N-benzyl-3-[(1S)-2-hydroxy-1-phenylethyl]-2-N-(4-methoxyphenyl)-9-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23754921 |
| Molecular Formula | C39H43N3O5S |
| Molecular Weight | 665.86 g/mol |
| Exact Mass | 665.29 |
| IUPAC Name | (5S,6S,7R)-6-N-benzyl-3-[(1S)-2-hydroxy-1-phenylethyl]-2-N-(4-methoxyphenyl)-9-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)[C@@H]1[C@H]2C(=O)N([C@H](CO)c3ccccc3)C(C(=O)N(CC=C)c3ccc(OC)cc3)C23S[C@@H]1CC3C |
| InChI | InChI=1S/C39H43N3O5S/c1-5-21-40(24-27-13-9-7-10-14-27)36(44)33-32-23-26(3)39(48-32)34(33)37(45)42(31(25-43)28-15-11-8-12-16-28)35(39)38(46)41(22-6-2)29-17-19-30(47-4)20-18-29/h5-20,26,31-35,43H,1-2,21-25H2,3-4H3/t26?,31-,32-,33+,34+,35?,39?/m1/s1 |
| InChIKey | ZAFDBWYNDZSYFK-DCRXESAGSA-N |
| XLogP | 5.50 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.86 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|