C30H41N3O5S — CID 23981690
(5S,6S,7R)-3-[(2R)-1-hydroxypropan-2-yl]-2-N-(4-methoxyphenyl)-9-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23981690) has the molecular formula C30H41N3O5S and a molecular weight of 555.74 g/mol. Its IUPAC name is (5S,6S,7R)-3-[(2R)-1-hydroxypropan-2-yl]-2-N-(4-methoxyphenyl)-9-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-3-[(2R)-1-hydroxypropan-2-yl]-2-N-(4-methoxyphenyl)-9-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23981690 |
| Molecular Formula | C30H41N3O5S |
| Molecular Weight | 555.74 g/mol |
| Exact Mass | 555.28 |
| IUPAC Name | (5S,6S,7R)-3-[(2R)-1-hydroxypropan-2-yl]-2-N-(4-methoxyphenyl)-9-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCC)C(=O)[C@@H]1[C@H]2C(=O)N([C@H](C)CO)C(C(=O)N(CC=C)c3ccc(OC)cc3)C23S[C@@H]1CC3C |
| InChI | InChI=1S/C30H41N3O5S/c1-7-14-31(15-8-2)27(35)24-23-17-19(4)30(39-23)25(24)28(36)33(20(5)18-34)26(30)29(37)32(16-9-3)21-10-12-22(38-6)13-11-21/h7,9-13,19-20,23-26,34H,1,3,8,14-18H2,2,4-6H3/t19?,20-,23-,24+,25+,26?,30?/m1/s1 |
| InChIKey | RKVYSOCUTQWISO-PNBQRIFKSA-N |
| XLogP | 3.36 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.74 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|