C35H43N3O4S — CID 23841876
(5S,6S,7R)-2-N,6-N-dibenzyl-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23841876) has the molecular formula C35H43N3O4S and a molecular weight of 601.81 g/mol. Its IUPAC name is (5S,6S,7R)-2-N,6-N-dibenzyl-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N,6-N-dibenzyl-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23841876 |
| Molecular Formula | C35H43N3O4S |
| Molecular Weight | 601.81 g/mol |
| Exact Mass | 601.30 |
| IUPAC Name | (5S,6S,7R)-2-N,6-N-dibenzyl-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)C1N(C(CC)CO)C(=O)[C@@H]2[C@@H](C(=O)N(CC=C)Cc3ccccc3)[C@H]3CC(C)C12S3 |
| InChI | InChI=1S/C35H43N3O4S/c1-5-18-36(21-25-14-10-8-11-15-25)32(40)29-28-20-24(4)35(43-28)30(29)33(41)38(27(7-3)23-39)31(35)34(42)37(19-6-2)22-26-16-12-9-13-17-26/h5-6,8-17,24,27-31,39H,1-2,7,18-23H2,3-4H3/t24?,27?,28-,29+,30+,31?,35?/m1/s1 |
| InChIKey | MJHOWBJWOLJAIU-HXJZVZSJSA-N |
| XLogP | 4.52 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.81 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|