C34H47N3O4S — CID 23841456
(5S,6R,7S)-6-N-benzyl-2-N-cyclohexyl-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23841456) has the molecular formula C34H47N3O4S and a molecular weight of 593.83 g/mol. Its IUPAC name is (5S,6R,7S)-6-N-benzyl-2-N-cyclohexyl-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-6-N-benzyl-2-N-cyclohexyl-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23841456 |
| Molecular Formula | C34H47N3O4S |
| Molecular Weight | 593.83 g/mol |
| Exact Mass | 593.33 |
| IUPAC Name | (5S,6R,7S)-6-N-benzyl-2-N-cyclohexyl-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)[C@@H]1[C@@H]2CC(C)C3(S2)C(C(=O)N(CC=C)C2CCCCC2)N([C@@H](CC)CO)C(=O)[C@H]13 |
| InChI | InChI=1S/C34H47N3O4S/c1-5-18-35(21-24-14-10-8-11-15-24)31(39)28-27-20-23(4)34(42-27)29(28)32(40)37(25(7-3)22-38)30(34)33(41)36(19-6-2)26-16-12-9-13-17-26/h5-6,8,10-11,14-15,23,25-30,38H,1-2,7,9,12-13,16-22H2,3-4H3/t23?,25-,27-,28+,29-,30?,34?/m0/s1 |
| InChIKey | DERATWRAKLUDLU-YJHAYADISA-N |
| XLogP | 4.66 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.83 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|