C35H51N3O4S — CID 23812684
(5S,6R,7S)-6-N-benzyl-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-2-N-pentan-2-yl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23812684) has the molecular formula C35H51N3O4S and a molecular weight of 609.88 g/mol. Its IUPAC name is (5S,6R,7S)-6-N-benzyl-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-2-N-pentan-2-yl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-6-N-benzyl-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-2-N-pentan-2-yl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23812684 |
| Molecular Formula | C35H51N3O4S |
| Molecular Weight | 609.88 g/mol |
| Exact Mass | 609.36 |
| IUPAC Name | (5S,6R,7S)-6-N-benzyl-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-9-methyl-4-oxo-2-N-pentan-2-yl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)[C@@H]1[C@@H]2CC(C)C3(S2)C(C(=O)N(CC=C)C(C)CCC)N([C@@H](CO)[C@@H](C)CC)C(=O)[C@H]13 |
| InChI | InChI=1S/C35H51N3O4S/c1-8-15-25(7)37(19-10-3)34(42)31-35-24(6)20-28(43-35)29(30(35)33(41)38(31)27(22-39)23(5)11-4)32(40)36(18-9-2)21-26-16-13-12-14-17-26/h9-10,12-14,16-17,23-25,27-31,39H,2-3,8,11,15,18-22H2,1,4-7H3/t23-,24?,25?,27-,28-,29+,30-,31?,35?/m0/s1 |
| InChIKey | XSCAITJTRUUQHJ-ARNQJZRTSA-N |
| XLogP | 5.15 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.88 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|