C29H47N3O4S — CID 25085504
(5S,6S,7R)-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-2-N-pentan-2-yl-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 25085504) has the molecular formula C29H47N3O4S and a molecular weight of 533.78 g/mol. Its IUPAC name is (5S,6S,7R)-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-2-N-pentan-2-yl-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-2-N-pentan-2-yl-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 25085504 |
| Molecular Formula | C29H47N3O4S |
| Molecular Weight | 533.78 g/mol |
| Exact Mass | 533.33 |
| IUPAC Name | (5S,6S,7R)-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-2-N-pentan-2-yl-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCC)C(=O)[C@@H]1[C@H]2C(=O)N(C(CC)CO)C(C(=O)N(CC=C)C(C)CCC)C23S[C@@H]1CC3C |
| InChI | InChI=1S/C29H47N3O4S/c1-8-13-20(7)31(16-11-4)28(36)25-29-19(6)17-22(37-29)23(26(34)30(14-9-2)15-10-3)24(29)27(35)32(25)21(12-5)18-33/h9,11,19-25,33H,2,4,8,10,12-18H2,1,3,5-7H3/t19?,20?,21?,22-,23+,24+,25?,29?/m1/s1 |
| InChIKey | APQGZRWQOHQNIE-ZCXTVVCSSA-N |
| XLogP | 3.72 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.78 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|