C27H35BrN2O5S — CID 23950777
ethyl (5S,6R,7R)-8-bromo-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23950777) has the molecular formula C27H35BrN2O5S and a molecular weight of 579.56 g/mol. Its IUPAC name is ethyl (5S,6R,7R)-8-bromo-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6R,7R)-8-bromo-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23950777 |
| Molecular Formula | C27H35BrN2O5S |
| Molecular Weight | 579.56 g/mol |
| Exact Mass | 578.15 |
| IUPAC Name | ethyl (5S,6R,7R)-8-bromo-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCN(C(=O)C1N([C@@H](CC)CO)C(=O)[C@@H]2[C@H](C(=O)OCC)[C@H]3SC12CC3Br)c1c(C)cccc1C |
| InChI | InChI=1S/C27H35BrN2O5S/c1-6-12-29(21-15(4)10-9-11-16(21)5)25(33)23-27-13-18(28)22(36-27)19(26(34)35-8-3)20(27)24(32)30(23)17(7-2)14-31/h6,9-11,17-20,22-23,31H,1,7-8,12-14H2,2-5H3/t17-,18?,19-,20-,22-,23?,27?/m0/s1 |
| InChIKey | OEGSFHQRSYSNFN-FVKVAMQJSA-N |
| XLogP | 3.62 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|