C28H36BrN3O4S — CID 23841478
(5S,6R,7R)-8-bromo-2-N-(2,6-dimethylphenyl)-3-[(2R)-1-hydroxypropan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23841478) has the molecular formula C28H36BrN3O4S and a molecular weight of 590.58 g/mol. Its IUPAC name is (5S,6R,7R)-8-bromo-2-N-(2,6-dimethylphenyl)-3-[(2R)-1-hydroxypropan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7R)-8-bromo-2-N-(2,6-dimethylphenyl)-3-[(2R)-1-hydroxypropan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23841478 |
| Molecular Formula | C28H36BrN3O4S |
| Molecular Weight | 590.58 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | (5S,6R,7R)-8-bromo-2-N-(2,6-dimethylphenyl)-3-[(2R)-1-hydroxypropan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C)C(=O)[C@H]1[C@H]2C(=O)N([C@H](C)CO)C(C(=O)N(CC=C)c3c(C)cccc3C)C23CC(Br)[C@@H]1S3 |
| InChI | InChI=1S/C28H36BrN3O4S/c1-7-12-30(6)25(34)20-21-26(35)32(18(5)15-33)24(28(21)14-19(29)23(20)37-28)27(36)31(13-8-2)22-16(3)10-9-11-17(22)4/h7-11,18-21,23-24,33H,1-2,12-15H2,3-6H3/t18-,19?,20+,21+,23+,24?,28?/m1/s1 |
| InChIKey | WKRYOROPRKZWIK-YEFVZQJVSA-N |
| XLogP | 3.31 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.58 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|