C28H35BrClN3O4S — CID 23897713
(5S,6R,7R)-8-bromo-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23897713) has the molecular formula C28H35BrClN3O4S and a molecular weight of 625.03 g/mol. Its IUPAC name is (5S,6R,7R)-8-bromo-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7R)-8-bromo-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23897713 |
| Molecular Formula | C28H35BrClN3O4S |
| Molecular Weight | 625.03 g/mol |
| Exact Mass | 623.12 |
| IUPAC Name | (5S,6R,7R)-8-bromo-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C)C(=O)[C@H]1[C@H]2C(=O)N([C@@H](CO)C(C)C)C(C(=O)N(CC=C)c3ccccc3Cl)C23CC(Br)[C@@H]1S3 |
| InChI | InChI=1S/C28H35BrClN3O4S/c1-6-12-31(5)25(35)21-22-26(36)33(20(15-34)16(3)4)24(28(22)14-17(29)23(21)38-28)27(37)32(13-7-2)19-11-9-8-10-18(19)30/h6-11,16-17,20-24,34H,1-2,12-15H2,3-5H3/t17?,20-,21-,22-,23-,24?,28?/m0/s1 |
| InChIKey | GHPQRNPBPUESDF-BIEXNMEISA-N |
| XLogP | 3.98 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.03 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|