C33H37BrClN3O4S — CID 23869884
(5S,6S,7S)-8-bromo-2-N-(4-chlorophenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23869884) has the molecular formula C33H37BrClN3O4S and a molecular weight of 687.10 g/mol. Its IUPAC name is (5S,6S,7S)-8-bromo-2-N-(4-chlorophenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7S)-8-bromo-2-N-(4-chlorophenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23869884 |
| Molecular Formula | C33H37BrClN3O4S |
| Molecular Weight | 687.10 g/mol |
| Exact Mass | 685.14 |
| IUPAC Name | (5S,6S,7S)-8-bromo-2-N-(4-chlorophenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)C1N([C@@H](CO)C(C)C)C(=O)[C@@H]2[C@@H](C(=O)N(CC=C)c3ccccc3)[C@@H]3SC12CC3Br)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C33H37BrClN3O4S/c1-5-16-36(22-10-8-7-9-11-22)30(40)26-27-31(41)38(25(19-39)20(3)4)29(33(27)18-24(34)28(26)43-33)32(42)37(17-6-2)23-14-12-21(35)13-15-23/h5-15,20,24-29,39H,1-2,16-19H2,3-4H3/t24?,25-,26+,27-,28+,29?,33?/m0/s1 |
| InChIKey | LBQGVSIGDSZQHO-RWARLVTISA-N |
| XLogP | 5.56 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.10 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|