C31H40BrClN2O5S — CID 23810907
hex-5-enyl (5S,6S,7S)-8-bromo-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23810907) has the molecular formula C31H40BrClN2O5S and a molecular weight of 668.09 g/mol. Its IUPAC name is hex-5-enyl (5S,6S,7S)-8-bromo-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | hex-5-enyl (5S,6S,7S)-8-bromo-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23810907 |
| Molecular Formula | C31H40BrClN2O5S |
| Molecular Weight | 668.09 g/mol |
| Exact Mass | 666.15 |
| IUPAC Name | hex-5-enyl (5S,6S,7S)-8-bromo-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCCOC(=O)[C@H]1[C@@H]2SC3(CC2Br)C(C(=O)N(CC=C)c2ccc(Cl)cc2)N([C@@H](CO)[C@@H](C)CC)C(=O)[C@H]13 |
| InChI | InChI=1S/C31H40BrClN2O5S/c1-5-8-9-10-16-40-30(39)24-25-28(37)35(23(18-36)19(4)7-3)27(31(25)17-22(32)26(24)41-31)29(38)34(15-6-2)21-13-11-20(33)12-14-21/h5-6,11-14,19,22-27,36H,1-2,7-10,15-18H2,3-4H3/t19-,22?,23-,24+,25-,26+,27?,31?/m0/s1 |
| InChIKey | ADAXNUJCPOVLOZ-JPBSHAEGSA-N |
| XLogP | 5.63 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.09 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|