C28H34BrClN2O5S — CID 23951464
prop-2-enyl (5S,6R,7R)-8-bromo-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23951464) has the molecular formula C28H34BrClN2O5S and a molecular weight of 626.01 g/mol. Its IUPAC name is prop-2-enyl (5S,6R,7R)-8-bromo-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | prop-2-enyl (5S,6R,7R)-8-bromo-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23951464 |
| Molecular Formula | C28H34BrClN2O5S |
| Molecular Weight | 626.01 g/mol |
| Exact Mass | 624.11 |
| IUPAC Name | prop-2-enyl (5S,6R,7R)-8-bromo-2-[(2-chlorophenyl)-prop-2-enylcarbamoyl]-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCOC(=O)[C@H]1[C@H]2C(=O)N([C@@H](CO)[C@@H](C)CC)C(C(=O)N(CC=C)c3ccccc3Cl)C23CC(Br)[C@@H]1S3 |
| InChI | InChI=1S/C28H34BrClN2O5S/c1-5-12-31(19-11-9-8-10-18(19)30)26(35)24-28-14-17(29)23(38-28)21(27(36)37-13-6-2)22(28)25(34)32(24)20(15-33)16(4)7-3/h5-6,8-11,16-17,20-24,33H,1-2,7,12-15H2,3-4H3/t16-,17?,20-,21-,22-,23-,24?,28?/m0/s1 |
| InChIKey | HZRYAUXRHJCRIC-KSIBQHIOSA-N |
| XLogP | 4.46 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.01 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|