C30H39BrN2O6S — CID 23923714
hex-5-enyl (5S,6R,7R)-8-bromo-3-[(2S)-1-hydroxybutan-2-yl]-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23923714) has the molecular formula C30H39BrN2O6S and a molecular weight of 635.62 g/mol. Its IUPAC name is hex-5-enyl (5S,6R,7R)-8-bromo-3-[(2S)-1-hydroxybutan-2-yl]-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | hex-5-enyl (5S,6R,7R)-8-bromo-3-[(2S)-1-hydroxybutan-2-yl]-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23923714 |
| Molecular Formula | C30H39BrN2O6S |
| Molecular Weight | 635.62 g/mol |
| Exact Mass | 634.17 |
| IUPAC Name | hex-5-enyl (5S,6R,7R)-8-bromo-3-[(2S)-1-hydroxybutan-2-yl]-2-[(4-methoxyphenyl)-prop-2-enylcarbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCCOC(=O)[C@H]1[C@H]2C(=O)N([C@@H](CC)CO)C(C(=O)N(CC=C)c3ccc(OC)cc3)C23CC(Br)[C@@H]1S3 |
| InChI | InChI=1S/C30H39BrN2O6S/c1-5-8-9-10-16-39-29(37)23-24-27(35)33(19(7-3)18-34)26(30(24)17-22(31)25(23)40-30)28(36)32(15-6-2)20-11-13-21(38-4)14-12-20/h5-6,11-14,19,22-26,34H,1-2,7-10,15-18H2,3-4H3/t19-,22?,23-,24-,25-,26?,30?/m0/s1 |
| InChIKey | VTLMEDFHHWZXDW-FXQDNFNNSA-N |
| XLogP | 4.35 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.62 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|