C36H38BrN3O4S — CID 23754807
(5S,6S,7S)-8-bromo-3-[(2S)-1-hydroxybutan-2-yl]-2-N-naphthalen-2-yl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23754807) has the molecular formula C36H38BrN3O4S and a molecular weight of 688.69 g/mol. Its IUPAC name is (5S,6S,7S)-8-bromo-3-[(2S)-1-hydroxybutan-2-yl]-2-N-naphthalen-2-yl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7S)-8-bromo-3-[(2S)-1-hydroxybutan-2-yl]-2-N-naphthalen-2-yl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23754807 |
| Molecular Formula | C36H38BrN3O4S |
| Molecular Weight | 688.69 g/mol |
| Exact Mass | 687.18 |
| IUPAC Name | (5S,6S,7S)-8-bromo-3-[(2S)-1-hydroxybutan-2-yl]-2-N-naphthalen-2-yl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)C1N(C(CC)CO)C(=O)[C@@H]2[C@@H](C(=O)N(CC=C)c3ccccc3)[C@@H]3SC12CC3Br)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C36H38BrN3O4S/c1-4-18-38(26-14-8-7-9-15-26)33(42)29-30-34(43)40(25(6-3)22-41)32(36(30)21-28(37)31(29)45-36)35(44)39(19-5-2)27-17-16-23-12-10-11-13-24(23)20-27/h4-5,7-17,20,25,28-32,41H,1-2,6,18-19,21-22H2,3H3/t25?,28?,29-,30+,31-,32?,36?/m1/s1 |
| InChIKey | OYIULHGBMVILFN-RJGVNAJNSA-N |
| XLogP | 5.81 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.69 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|