C33H39BrN2O5S — CID 23752720
but-3-enyl (5S,6R,7R)-8-bromo-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23752720) has the molecular formula C33H39BrN2O5S and a molecular weight of 655.66 g/mol. Its IUPAC name is but-3-enyl (5S,6R,7R)-8-bromo-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | but-3-enyl (5S,6R,7R)-8-bromo-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23752720 |
| Molecular Formula | C33H39BrN2O5S |
| Molecular Weight | 655.66 g/mol |
| Exact Mass | 654.18 |
| IUPAC Name | but-3-enyl (5S,6R,7R)-8-bromo-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-[naphthalen-2-yl(prop-2-enyl)carbamoyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCOC(=O)[C@H]1[C@H]2C(=O)N([C@@H](CO)CC(C)C)C(C(=O)N(CC=C)c3ccc4ccccc4c3)C23CC(Br)[C@@H]1S3 |
| InChI | InChI=1S/C33H39BrN2O5S/c1-5-7-15-41-32(40)26-27-30(38)36(24(19-37)16-20(3)4)29(33(27)18-25(34)28(26)42-33)31(39)35(14-6-2)23-13-12-21-10-8-9-11-22(21)17-23/h5-6,8-13,17,20,24-29,37H,1-2,7,14-16,18-19H2,3-4H3/t24-,25?,26+,27+,28+,29?,33?/m1/s1 |
| InChIKey | VKEUCYIWUQFTTJ-GGPAQJDASA-N |
| XLogP | 5.35 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.66 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|