C27H34BrN3O5S — CID 23953655
(5S,6S,7S)-8-bromo-3-[(2R)-1-hydroxypropan-2-yl]-2-N-(4-methoxyphenyl)-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23953655) has the molecular formula C27H34BrN3O5S and a molecular weight of 592.56 g/mol. Its IUPAC name is (5S,6S,7S)-8-bromo-3-[(2R)-1-hydroxypropan-2-yl]-2-N-(4-methoxyphenyl)-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7S)-8-bromo-3-[(2R)-1-hydroxypropan-2-yl]-2-N-(4-methoxyphenyl)-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23953655 |
| Molecular Formula | C27H34BrN3O5S |
| Molecular Weight | 592.56 g/mol |
| Exact Mass | 591.14 |
| IUPAC Name | (5S,6S,7S)-8-bromo-3-[(2R)-1-hydroxypropan-2-yl]-2-N-(4-methoxyphenyl)-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C)C(=O)[C@H]1[C@@H]2SC3(CC2Br)C(C(=O)N(CC=C)c2ccc(OC)cc2)N([C@H](C)CO)C(=O)[C@H]13 |
| InChI | InChI=1S/C27H34BrN3O5S/c1-6-12-29(4)24(33)20-21-25(34)31(16(3)15-32)23(27(21)14-19(28)22(20)37-27)26(35)30(13-7-2)17-8-10-18(36-5)11-9-17/h6-11,16,19-23,32H,1-2,12-15H2,3-5H3/t16-,19?,20-,21+,22-,23?,27?/m1/s1 |
| InChIKey | LPVIMYYAUZJEMX-PZAIDUEZSA-N |
| XLogP | 2.70 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.56 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|