C29H39N3O5S — CID 23754065
(5S,6R,7S)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-2-N-(4-methoxyphenyl)-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23754065) has the molecular formula C29H39N3O5S and a molecular weight of 541.71 g/mol. Its IUPAC name is (5S,6R,7S)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-2-N-(4-methoxyphenyl)-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-2-N-(4-methoxyphenyl)-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23754065 |
| Molecular Formula | C29H39N3O5S |
| Molecular Weight | 541.71 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | (5S,6R,7S)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-2-N-(4-methoxyphenyl)-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C)C(=O)[C@@H]1[C@@H]2CCC3(S2)C(C(=O)N(CC=C)c2ccc(OC)cc2)N([C@@H](CO)C(C)C)C(=O)[C@H]13 |
| InChI | InChI=1S/C29H39N3O5S/c1-7-15-30(5)26(34)23-22-13-14-29(38-22)24(23)27(35)32(21(17-33)18(3)4)25(29)28(36)31(16-8-2)19-9-11-20(37-6)12-10-19/h7-12,18,21-25,33H,1-2,13-17H2,3-6H3/t21-,22-,23+,24-,25?,29?/m0/s1 |
| InChIKey | XERUHRKUMLIRJR-MTZSBHPCSA-N |
| XLogP | 2.97 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.71 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|