C31H37N3O4S — CID 23953342
(5S,6S,7R)-3-[(2S)-1-hydroxybutan-2-yl]-6-N-methyl-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23953342) has the molecular formula C31H37N3O4S and a molecular weight of 547.72 g/mol. Its IUPAC name is (5S,6S,7R)-3-[(2S)-1-hydroxybutan-2-yl]-6-N-methyl-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-3-[(2S)-1-hydroxybutan-2-yl]-6-N-methyl-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23953342 |
| Molecular Formula | C31H37N3O4S |
| Molecular Weight | 547.72 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | (5S,6S,7R)-3-[(2S)-1-hydroxybutan-2-yl]-6-N-methyl-2-N-naphthalen-2-yl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C)C(=O)[C@@H]1[C@H]2C(=O)N(C(CC)CO)C(C(=O)N(CC=C)c3ccc4ccccc4c3)C23CC[C@H]1S3 |
| InChI | InChI=1S/C31H37N3O4S/c1-5-16-32(4)28(36)25-24-14-15-31(39-24)26(25)29(37)34(22(7-3)19-35)27(31)30(38)33(17-6-2)23-13-12-20-10-8-9-11-21(20)18-23/h5-6,8-13,18,22,24-27,35H,1-2,7,14-17,19H2,3-4H3/t22?,24-,25+,26+,27?,31?/m1/s1 |
| InChIKey | HYLOUCBCJQIDFW-UKNNREQMSA-N |
| XLogP | 3.87 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.72 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|