C36H45N3O5S — CID 23953050
(5S,6R,7S)-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23953050) has the molecular formula C36H45N3O5S and a molecular weight of 631.84 g/mol. Its IUPAC name is (5S,6R,7S)-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23953050 |
| Molecular Formula | C36H45N3O5S |
| Molecular Weight | 631.84 g/mol |
| Exact Mass | 631.31 |
| IUPAC Name | (5S,6R,7S)-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)[C@@H]1[C@@H]2CCC3(S2)C(C(=O)N(CC=C)c2cc(C)ccc2C)N(C(CC)CO)C(=O)[C@H]13)c1ccc(OCC)cc1 |
| InChI | InChI=1S/C36H45N3O5S/c1-7-19-37(26-13-15-27(16-14-26)44-10-4)33(41)30-29-17-18-36(45-29)31(30)34(42)39(25(9-3)22-40)32(36)35(43)38(20-8-2)28-21-23(5)11-12-24(28)6/h7-8,11-16,21,25,29-32,40H,1-2,9-10,17-20,22H2,3-6H3/t25?,29-,30+,31-,32?,36?/m0/s1 |
| InChIKey | HUKPMAVWRYSHAH-DDYDSCGSSA-N |
| XLogP | 5.30 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.84 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|