C39H49N3O5S — CID 23754282
(5S,6S,7R)-2-N-cyclohexyl-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23754282) has the molecular formula C39H49N3O5S and a molecular weight of 671.90 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-cyclohexyl-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-cyclohexyl-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23754282 |
| Molecular Formula | C39H49N3O5S |
| Molecular Weight | 671.90 g/mol |
| Exact Mass | 671.34 |
| IUPAC Name | (5S,6S,7R)-2-N-cyclohexyl-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)[C@@H]1[C@H]2C(=O)N([C@@H](CO)Cc3ccccc3)C(C(=O)N(CC=C)C3CCCCC3)C23CC[C@H]1S3)c1ccc(OCC)cc1 |
| InChI | InChI=1S/C39H49N3O5S/c1-4-23-40(29-17-19-31(20-18-29)47-6-3)36(44)33-32-21-22-39(48-32)34(33)37(45)42(30(26-43)25-27-13-9-7-10-14-27)35(39)38(46)41(24-5-2)28-15-11-8-12-16-28/h4-5,7,9-10,13-14,17-20,28,30,32-35,43H,1-2,6,8,11-12,15-16,21-26H2,3H3/t30-,32-,33+,34+,35?,39?/m1/s1 |
| InChIKey | XWZYVEYOPCHPPQ-HBPDTQPKSA-N |
| XLogP | 5.65 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.90 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|